C21H24F6O13 — CID 102575208
2,2,2-trifluoroethyl (Z)-3-[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3-(2,2,2-trifluoroethoxy)prop-2-enoate (PubChem CID 102575208) has the molecular formula C21H24F6O13 and a molecular weight of 598.40 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (Z)-3-[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3-(2,2,2-trifluoroethoxy)prop-2-enoate.
| Compound Name | 2,2,2-trifluoroethyl (Z)-3-[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3-(2,2,2-trifluoroethoxy)prop-2-enoate |
|---|---|
| PubChem CID | 102575208 |
| Molecular Formula | C21H24F6O13 |
| Molecular Weight | 598.40 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | 2,2,2-trifluoroethyl (Z)-3-[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3-(2,2,2-trifluoroethoxy)prop-2-enoate |
| SMILES | CC(=O)OC[C@H]1O[C@H](O/C(=C\C(=O)OCC(F)(F)F)OCC(F)(F)F)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H24F6O13/c1-9(28)33-6-13-16(36-10(2)29)17(37-11(3)30)18(38-12(4)31)19(39-13)40-15(35-8-21(25,26)27)5-14(32)34-7-20(22,23)24/h5,13,16-19H,6-8H2,1-4H3/b15-5-/t13-,16-,17+,18+,19-/m1/s1 |
| InChIKey | BXCVCPLLLWKYGP-WFOBSRNNSA-N |
| XLogP | 1.61 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|