C30H39N3O10 — CID 10258038
1-O-tert-butyl 4-O-(4-nitrophenyl) 2-[2-[5-[acetyl(phenylmethoxy)amino]pentylamino]-2-oxoethyl]-2-hydroxybutanedioate (PubChem CID 10258038) has the molecular formula C30H39N3O10 and a molecular weight of 601.65 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-(4-nitrophenyl) 2-[2-[5-[acetyl(phenylmethoxy)amino]pentylamino]-2-oxoethyl]-2-hydroxybutanedioate.
| Compound Name | 1-O-tert-butyl 4-O-(4-nitrophenyl) 2-[2-[5-[acetyl(phenylmethoxy)amino]pentylamino]-2-oxoethyl]-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 10258038 |
| Molecular Formula | C30H39N3O10 |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | 1-O-tert-butyl 4-O-(4-nitrophenyl) 2-[2-[5-[acetyl(phenylmethoxy)amino]pentylamino]-2-oxoethyl]-2-hydroxybutanedioate |
| SMILES | CC(=O)N(CCCCCNC(=O)CC(O)(CC(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)OC(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C30H39N3O10/c1-22(34)32(41-21-23-11-7-5-8-12-23)18-10-6-9-17-31-26(35)19-30(38,28(37)43-29(2,3)4)20-27(36)42-25-15-13-24(14-16-25)33(39)40/h5,7-8,11-16,38H,6,9-10,17-21H2,1-4H3,(H,31,35) |
| InChIKey | RYTHRNDQISZSSK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 174.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|