C36H76O7Si4 — CID 102592527
tert-butyl (2Z)-2-[(3R,4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-ylidene]acetate (PubChem CID 102592527) has the molecular formula C36H76O7Si4 and a molecular weight of 733.34 g/mol. Its IUPAC name is tert-butyl (2Z)-2-[(3R,4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-ylidene]acetate.
| Compound Name | tert-butyl (2Z)-2-[(3R,4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-ylidene]acetate |
|---|---|
| PubChem CID | 102592527 |
| Molecular Formula | C36H76O7Si4 |
| Molecular Weight | 733.34 g/mol |
| Exact Mass | 732.47 |
| IUPAC Name | tert-butyl (2Z)-2-[(3R,4S,5S)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-ylidene]acetate |
| SMILES | CC(C)(C)OC(=O)/C=C1\O[C@@H]([C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H76O7Si4/c1-32(2,3)40-28(37)24-26-30(42-46(20,21)35(10,11)12)31(43-47(22,23)36(13,14)15)29(39-26)27(41-45(18,19)34(7,8)9)25-38-44(16,17)33(4,5)6/h24,27,29-31H,25H2,1-23H3/b26-24-/t27-,29+,30+,31+/m1/s1 |
| InChIKey | MZAJHAUYUDUPNH-BZXZHLMMSA-N |
| XLogP | 10.80 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.34 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|