C9H7Cl2F2N3S — CID 102868932
3,5-dichloro-N-(1,1-difluoropropan-2-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine (PubChem CID 102868932) has the molecular formula C9H7Cl2F2N3S and a molecular weight of 298.15 g/mol. Its IUPAC name is 3,5-dichloro-N-(1,1-difluoropropan-2-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine.
| Compound Name | 3,5-dichloro-N-(1,1-difluoropropan-2-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
|---|---|
| PubChem CID | 102868932 |
| Molecular Formula | C9H7Cl2F2N3S |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | 3,5-dichloro-N-(1,1-difluoropropan-2-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
| SMILES | CC(Nc1c(Cl)cc(Cl)c2c1N=S=N2)C(F)F |
| InChI | InChI=1S/C9H7Cl2F2N3S/c1-3(9(12)13)14-6-4(10)2-5(11)7-8(6)16-17-15-7/h2-3,9,14H,1H3 |
| InChIKey | KSBGOTXBPTYXOE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |