C10H5Cl2F3N4S — CID 103367349
2-[[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]methyl]-3,3,3-trifluoropropanenitrile (PubChem CID 103367349) has the molecular formula C10H5Cl2F3N4S and a molecular weight of 341.15 g/mol. Its IUPAC name is 2-[[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]methyl]-3,3,3-trifluoropropanenitrile.
| Compound Name | 2-[[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]methyl]-3,3,3-trifluoropropanenitrile |
|---|---|
| PubChem CID | 103367349 |
| Molecular Formula | C10H5Cl2F3N4S |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 2-[[(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)amino]methyl]-3,3,3-trifluoropropanenitrile |
| SMILES | N#CC(CNc1c(Cl)cc(Cl)c2c1N=S=N2)C(F)(F)F |
| InChI | InChI=1S/C10H5Cl2F3N4S/c11-5-1-6(12)8-9(19-20-18-8)7(5)17-3-4(2-16)10(13,14)15/h1,4,17H,3H2 |
| InChIKey | ZCGJEHBTMPFUNI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 60.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |