C26H38FNO8 — CID 10301187
(3S,7S,10R,11S,12R,16R)-10-ethyl-3-[(Z)-1-fluoro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,13,17-trioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 10301187) has the molecular formula C26H38FNO8 and a molecular weight of 511.59 g/mol. Its IUPAC name is (3S,7S,10R,11S,12R,16R)-10-ethyl-3-[(Z)-1-fluoro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,13,17-trioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (3S,7S,10R,11S,12R,16R)-10-ethyl-3-[(Z)-1-fluoro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,13,17-trioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 10301187 |
| Molecular Formula | C26H38FNO8 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | (3S,7S,10R,11S,12R,16R)-10-ethyl-3-[(Z)-1-fluoro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,12,16-tetramethyl-4,13,17-trioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC[C@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@H](/C(F)=C/c2coc(C)n2)CC2O[C@]2(C)CCO[C@H](C)[C@H]1O |
| InChI | InChI=1S/C26H38FNO8/c1-7-17-23(31)14(2)33-9-8-26(6)21(36-26)11-19(18(27)10-16-13-34-15(3)28-16)35-22(30)12-20(29)25(4,5)24(17)32/h10,13-14,17,19-21,23,29,31H,7-9,11-12H2,1-6H3/b18-10-/t14-,17-,19+,20+,21?,23-,26-/m1/s1 |
| InChIKey | PHFPAKITYOOPSP-DAIOUZBPSA-N |
| XLogP | 3.30 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|