C7H11BrO — CID 10330180
(1S)-4-bromo-2,2-dimethylcyclopent-3-en-1-ol (PubChem CID 10330180) has the molecular formula C7H11BrO and a molecular weight of 191.07 g/mol. Its IUPAC name is (1S)-4-bromo-2,2-dimethylcyclopent-3-en-1-ol.
| Compound Name | (1S)-4-bromo-2,2-dimethylcyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 10330180 |
| Molecular Formula | C7H11BrO |
| Molecular Weight | 191.07 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | (1S)-4-bromo-2,2-dimethylcyclopent-3-en-1-ol |
| SMILES | CC1(C)C=C(Br)C[C@@H]1O |
| InChI | InChI=1S/C7H11BrO/c1-7(2)4-5(8)3-6(7)9/h4,6,9H,3H2,1-2H3/t6-/m0/s1 |
| InChIKey | HPXNZCMIZMTFKT-LURJTMIESA-N |
| XLogP | 2.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.07 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |