C34H48O4Si — CID 10347495
(3R,5S)-1-[(1S,2S,8S,8aR)-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-7-[tert-butyl(diphenyl)silyl]oxyheptane-3,5-diol (PubChem CID 10347495) has the molecular formula C34H48O4Si and a molecular weight of 548.84 g/mol. Its IUPAC name is (3R,5S)-1-[(1S,2S,8S,8aR)-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-7-[tert-butyl(diphenyl)silyl]oxyheptane-3,5-diol.
| Compound Name | (3R,5S)-1-[(1S,2S,8S,8aR)-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-7-[tert-butyl(diphenyl)silyl]oxyheptane-3,5-diol |
|---|---|
| PubChem CID | 10347495 |
| Molecular Formula | C34H48O4Si |
| Molecular Weight | 548.84 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | (3R,5S)-1-[(1S,2S,8S,8aR)-8-hydroxy-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-7-[tert-butyl(diphenyl)silyl]oxyheptane-3,5-diol |
| SMILES | C[C@H]1C=CC2=CCC[C@H](O)[C@@H]2[C@H]1CC[C@@H](O)C[C@@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H48O4Si/c1-25-18-19-26-12-11-17-32(37)33(26)31(25)21-20-27(35)24-28(36)22-23-38-39(34(2,3)4,29-13-7-5-8-14-29)30-15-9-6-10-16-30/h5-10,12-16,18-19,25,27-28,31-33,35-37H,11,17,20-24H2,1-4H3/t25-,27+,28-,31-,32-,33-/m0/s1 |
| InChIKey | YIRXLUYCSPMDTA-XIKWJPAISA-N |
| XLogP | 5.36 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.84 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|