C34H48O9S — CID 10349097
ethyl (2S,4E,6E,10E)-12-acetyloxy-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2,5,11-trimethyldodeca-4,6,10-trienoate (PubChem CID 10349097) has the molecular formula C34H48O9S and a molecular weight of 632.82 g/mol. Its IUPAC name is ethyl (2S,4E,6E,10E)-12-acetyloxy-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2,5,11-trimethyldodeca-4,6,10-trienoate.
| Compound Name | ethyl (2S,4E,6E,10E)-12-acetyloxy-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2,5,11-trimethyldodeca-4,6,10-trienoate |
|---|---|
| PubChem CID | 10349097 |
| Molecular Formula | C34H48O9S |
| Molecular Weight | 632.82 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | ethyl (2S,4E,6E,10E)-12-acetyloxy-2-[(4R,6S)-6-[3-(benzenesulfonyl)-2-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2,5,11-trimethyldodeca-4,6,10-trienoate |
| SMILES | CCOC(=O)[C@@](C)(C/C=C(C)/C=C/CC/C=C(\C)COC(C)=O)[C@H]1C[C@@H](CC(=O)CS(=O)(=O)c2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C34H48O9S/c1-8-40-32(37)34(7,20-19-25(2)15-11-9-12-16-26(3)23-41-27(4)35)31-22-29(42-33(5,6)43-31)21-28(36)24-44(38,39)30-17-13-10-14-18-30/h10-11,13-19,29,31H,8-9,12,20-24H2,1-7H3/b15-11+,25-19+,26-16+/t29-,31-,34+/m1/s1 |
| InChIKey | AZQAUYYRRKICRL-LIBSCTFUSA-N |
| XLogP | 6.08 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.82 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|