C24H17N5O4S — CID 10367490
11-ethoxy-4-(2-nitrophenyl)-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-12-carbonitrile (PubChem CID 10367490) has the molecular formula C24H17N5O4S and a molecular weight of 471.50 g/mol. Its IUPAC name is 11-ethoxy-4-(2-nitrophenyl)-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-12-carbonitrile.
| Compound Name | 11-ethoxy-4-(2-nitrophenyl)-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-12-carbonitrile |
|---|---|
| PubChem CID | 10367490 |
| Molecular Formula | C24H17N5O4S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 11-ethoxy-4-(2-nitrophenyl)-6-oxo-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-12-carbonitrile |
| SMILES | CCOc1nc2sc3c(c2c(-c2ccccc2)c1C#N)NC(c1ccccc1[N+](=O)[O-])NC3=O |
| InChI | InChI=1S/C24H17N5O4S/c1-2-33-23-15(12-25)17(13-8-4-3-5-9-13)18-19-20(34-24(18)28-23)22(30)27-21(26-19)14-10-6-7-11-16(14)29(31)32/h3-11,21,26H,2H2,1H3,(H,27,30) |
| InChIKey | DPLQCLQZAQAPTG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 130.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|