C8H15F2NO3S — CID 103914356
3-[(1,1-dioxothian-3-yl)amino]-1,1-difluoropropan-2-ol (PubChem CID 103914356) has the molecular formula C8H15F2NO3S and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-3-yl)amino]-1,1-difluoropropan-2-ol.
| Compound Name | 3-[(1,1-dioxothian-3-yl)amino]-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 103914356 |
| Molecular Formula | C8H15F2NO3S |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 3-[(1,1-dioxothian-3-yl)amino]-1,1-difluoropropan-2-ol |
| SMILES | O=S1(=O)CCCC(NCC(O)C(F)F)C1 |
| InChI | InChI=1S/C8H15F2NO3S/c9-8(10)7(12)4-11-6-2-1-3-15(13,14)5-6/h6-8,11-12H,1-5H2 |
| InChIKey | RKVNMHBKWQZAJF-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |