About 7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one
7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one (PubChem CID 1042676) has the molecular formula C17H26O4
and a molecular weight of 294.39 g/mol. Its IUPAC name is 7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one.
Molecular Properties
| Compound Name | 7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one |
| PubChem CID | 1042676 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one |
| SMILES | CC(C)(C)C(=O)C1=C(C(C)(C)C)OC2(CCCC2)OC1=O |
| InChI | InChI=1S/C17H26O4/c1-15(2,3)12(18)11-13(16(4,5)6)20-17(21-14(11)19)9-7-8-10-17/h7-10H2,1-6H3 |
| InChIKey | KFKGBHGBSHWRQG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one?
The IUPAC name of 7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one (CID 1042676) is 7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one.
What is the SMILES notation for 7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one?
The canonical SMILES for 7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one is CC(C)(C)C(=O)C1=C(C(C)(C)C)OC2(CCCC2)OC1=O.
What is the InChIKey of 7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one?
The InChIKey is KFKGBHGBSHWRQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O4/c1-15(2,3)12(18)11-13(16(4,5)6)20-17(21-14(11)19)9-7-8-10-17/h7-10H2,1-6H3.
What are the key properties of 7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one?
7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one has a molecular weight of 294.39 g/mol, XLogP of 3.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-8-(2,2-dimethylpropanoyl)-6,10-dioxaspiro[4.5]dec-7-en-9-one is sourced from PubChem (CID 1042676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).