C19H28O5 — CID 10427127
[(E,5E)-5-[(4R,6R)-4-acetyloxy-2,2,6-trimethylcyclohexylidene]-3-methyl-4-oxopent-2-enyl] acetate (PubChem CID 10427127) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is [(E,5E)-5-[(4R,6R)-4-acetyloxy-2,2,6-trimethylcyclohexylidene]-3-methyl-4-oxopent-2-enyl] acetate.
| Compound Name | [(E,5E)-5-[(4R,6R)-4-acetyloxy-2,2,6-trimethylcyclohexylidene]-3-methyl-4-oxopent-2-enyl] acetate |
|---|---|
| PubChem CID | 10427127 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | [(E,5E)-5-[(4R,6R)-4-acetyloxy-2,2,6-trimethylcyclohexylidene]-3-methyl-4-oxopent-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)C(=O)/C=C1\[C@H](C)C[C@@H](OC(C)=O)CC1(C)C |
| InChI | InChI=1S/C19H28O5/c1-12(7-8-23-14(3)20)18(22)10-17-13(2)9-16(24-15(4)21)11-19(17,5)6/h7,10,13,16H,8-9,11H2,1-6H3/b12-7+,17-10+/t13-,16-/m1/s1 |
| InChIKey | DAYRVAWVMVNATK-CFPPRTASSA-N |
| XLogP | 3.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|