C16H11N2O+ — CID 10450171
(1S,8R)-16-oxotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-4-diazonium (PubChem CID 10450171) has the molecular formula C16H11N2O+ and a molecular weight of 247.28 g/mol. Its IUPAC name is (1S,8R)-16-oxotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-4-diazonium.
| Compound Name | (1S,8R)-16-oxotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-4-diazonium |
|---|---|
| PubChem CID | 10450171 |
| Molecular Formula | C16H11N2O+ |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | (1S,8R)-16-oxotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-4-diazonium |
| SMILES | N#[N+]c1ccc2c(c1)[C@H]1CC(=O)[C@@H]2c2ccccc21 |
| InChI | InChI=1S/C16H11N2O/c17-18-9-5-6-12-13(7-9)14-8-15(19)16(12)11-4-2-1-3-10(11)14/h1-7,14,16H,8H2/q+1/t14-,16+/m0/s1 |
| InChIKey | FQELEFUMWBCVSI-GOEBONIOSA-N |
| XLogP | 3.72 |
| TPSA | 45.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|