C25H19Cl2NO3 — CID 10456510
benzyl 2-[(3E)-3-[1-(3,4-dichlorophenyl)ethylidene]-2-oxoindol-1-yl]acetate (PubChem CID 10456510) has the molecular formula C25H19Cl2NO3 and a molecular weight of 452.34 g/mol. Its IUPAC name is benzyl 2-[(3E)-3-[1-(3,4-dichlorophenyl)ethylidene]-2-oxoindol-1-yl]acetate.
| Compound Name | benzyl 2-[(3E)-3-[1-(3,4-dichlorophenyl)ethylidene]-2-oxoindol-1-yl]acetate |
|---|---|
| PubChem CID | 10456510 |
| Molecular Formula | C25H19Cl2NO3 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | benzyl 2-[(3E)-3-[1-(3,4-dichlorophenyl)ethylidene]-2-oxoindol-1-yl]acetate |
| SMILES | C/C(=C1\C(=O)N(CC(=O)OCc2ccccc2)c2ccccc21)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H19Cl2NO3/c1-16(18-11-12-20(26)21(27)13-18)24-19-9-5-6-10-22(19)28(25(24)30)14-23(29)31-15-17-7-3-2-4-8-17/h2-13H,14-15H2,1H3/b24-16+ |
| InChIKey | SKXJEEOSGHIOBH-LFVJCYFKSA-N |
| XLogP | 6.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|