C28H29N7O8S2 — CID 10484443
[(2S,3R,4S,6S)-4-azido-6-[[(6S,7R,9R)-7-azido-6-benzoyloxy-1,4-dithiaspiro[4.5]decan-9-yl]oxy]-2-methyloxan-3-yl] 4-nitrobenzoate (PubChem CID 10484443) has the molecular formula C28H29N7O8S2 and a molecular weight of 655.72 g/mol. Its IUPAC name is [(2S,3R,4S,6S)-4-azido-6-[[(6S,7R,9R)-7-azido-6-benzoyloxy-1,4-dithiaspiro[4.5]decan-9-yl]oxy]-2-methyloxan-3-yl] 4-nitrobenzoate.
| Compound Name | [(2S,3R,4S,6S)-4-azido-6-[[(6S,7R,9R)-7-azido-6-benzoyloxy-1,4-dithiaspiro[4.5]decan-9-yl]oxy]-2-methyloxan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 10484443 |
| Molecular Formula | C28H29N7O8S2 |
| Molecular Weight | 655.72 g/mol |
| Exact Mass | 655.15 |
| IUPAC Name | [(2S,3R,4S,6S)-4-azido-6-[[(6S,7R,9R)-7-azido-6-benzoyloxy-1,4-dithiaspiro[4.5]decan-9-yl]oxy]-2-methyloxan-3-yl] 4-nitrobenzoate |
| SMILES | C[C@@H]1O[C@H](O[C@@H]2C[C@@H](N=[N+]=[N-])[C@H](OC(=O)c3ccccc3)C3(C2)SCCS3)C[C@H](N=[N+]=[N-])[C@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H29N7O8S2/c1-16-24(42-26(36)18-7-9-19(10-8-18)35(38)39)21(31-33-29)14-23(40-16)41-20-13-22(32-34-30)25(28(15-20)44-11-12-45-28)43-27(37)17-5-3-2-4-6-17/h2-10,16,20-25H,11-15H2,1H3/t16-,20+,21-,22+,23+,24-,25-/m0/s1 |
| InChIKey | QFZPNFIGOWVKJM-HCQCJEEXSA-N |
| XLogP | 6.19 |
| TPSA | 211.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.72 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|