C10H10Cl2N2O6S — CID 104861912
(3S,4R)-1-(2,4-dichloro-3-nitrophenyl)sulfonylpyrrolidine-3,4-diol (PubChem CID 104861912) has the molecular formula C10H10Cl2N2O6S and a molecular weight of 357.17 g/mol. Its IUPAC name is (3S,4R)-1-(2,4-dichloro-3-nitrophenyl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-(2,4-dichloro-3-nitrophenyl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 104861912 |
| Molecular Formula | C10H10Cl2N2O6S |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | (3S,4R)-1-(2,4-dichloro-3-nitrophenyl)sulfonylpyrrolidine-3,4-diol |
| SMILES | O=[N+]([O-])c1c(Cl)ccc(S(=O)(=O)N2C[C@@H](O)[C@@H](O)C2)c1Cl |
| InChI | InChI=1S/C10H10Cl2N2O6S/c11-5-1-2-8(9(12)10(5)14(17)18)21(19,20)13-3-6(15)7(16)4-13/h1-2,6-7,15-16H,3-4H2/t6-,7+ |
| InChIKey | LIVIZMRXHSRCDH-KNVOCYPGSA-N |
| XLogP | 0.63 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|