C19H26O2 — CID 10493467
(1R,11S,15S)-5-methoxy-6,12,12-trimethyl-16-oxatetracyclo[9.5.0.01,15.03,8]hexadeca-3(8),4,6-triene (PubChem CID 10493467) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (1R,11S,15S)-5-methoxy-6,12,12-trimethyl-16-oxatetracyclo[9.5.0.01,15.03,8]hexadeca-3(8),4,6-triene.
| Compound Name | (1R,11S,15S)-5-methoxy-6,12,12-trimethyl-16-oxatetracyclo[9.5.0.01,15.03,8]hexadeca-3(8),4,6-triene |
|---|---|
| PubChem CID | 10493467 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (1R,11S,15S)-5-methoxy-6,12,12-trimethyl-16-oxatetracyclo[9.5.0.01,15.03,8]hexadeca-3(8),4,6-triene |
| SMILES | COc1cc2c(cc1C)CC[C@H]1C(C)(C)CC[C@@H]3O[C@@]31C2 |
| InChI | InChI=1S/C19H26O2/c1-12-9-13-5-6-16-18(2,3)8-7-17-19(16,21-17)11-14(13)10-15(12)20-4/h9-10,16-17H,5-8,11H2,1-4H3/t16-,17-,19+/m0/s1 |
| InChIKey | SLAHZRLQIQGNFW-JENIJYKNSA-N |
| XLogP | 4.07 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|