C29H31NO3 — CID 10503316
methyl (2R)-6,6-dimethyl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]heptanoate (PubChem CID 10503316) has the molecular formula C29H31NO3 and a molecular weight of 441.57 g/mol. Its IUPAC name is methyl (2R)-6,6-dimethyl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]heptanoate.
| Compound Name | methyl (2R)-6,6-dimethyl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]heptanoate |
|---|---|
| PubChem CID | 10503316 |
| Molecular Formula | C29H31NO3 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | methyl (2R)-6,6-dimethyl-5-oxo-2-[(9-phenylfluoren-9-yl)amino]heptanoate |
| SMILES | COC(=O)[C@@H](CCC(=O)C(C)(C)C)NC1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H31NO3/c1-28(2,3)26(31)19-18-25(27(32)33-4)30-29(20-12-6-5-7-13-20)23-16-10-8-14-21(23)22-15-9-11-17-24(22)29/h5-17,25,30H,18-19H2,1-4H3/t25-/m1/s1 |
| InChIKey | ZKOALNTZHJNKTB-RUZDIDTESA-N |
| XLogP | 5.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |