C22H28ClNO5 — CID 10574215
N-[1-[2-(2-chloroethyl)-4,5-dimethoxyphenyl]-2-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 10574215) has the molecular formula C22H28ClNO5 and a molecular weight of 421.92 g/mol. Its IUPAC name is N-[1-[2-(2-chloroethyl)-4,5-dimethoxyphenyl]-2-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | N-[1-[2-(2-chloroethyl)-4,5-dimethoxyphenyl]-2-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 10574215 |
| Molecular Formula | C22H28ClNO5 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-[1-[2-(2-chloroethyl)-4,5-dimethoxyphenyl]-2-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CC(NC(C)=O)c2cc(OC)c(OC)cc2CCCl)cc1OC |
| InChI | InChI=1S/C22H28ClNO5/c1-14(25)24-18(10-15-6-7-19(26-2)20(11-15)27-3)17-13-22(29-5)21(28-4)12-16(17)8-9-23/h6-7,11-13,18H,8-10H2,1-5H3,(H,24,25) |
| InChIKey | KIVFLMHDRHLINN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|