C12H7BrO2 — CID 10587604
(4aR,8bR)-8b-bromo-4aH-biphenylene-1,4-dione (PubChem CID 10587604) has the molecular formula C12H7BrO2 and a molecular weight of 263.09 g/mol. Its IUPAC name is (4aR,8bR)-8b-bromo-4aH-biphenylene-1,4-dione.
| Compound Name | (4aR,8bR)-8b-bromo-4aH-biphenylene-1,4-dione |
|---|---|
| PubChem CID | 10587604 |
| Molecular Formula | C12H7BrO2 |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | (4aR,8bR)-8b-bromo-4aH-biphenylene-1,4-dione |
| SMILES | O=C1C=CC(=O)[C@]2(Br)c3ccccc3[C@H]12 |
| InChI | InChI=1S/C12H7BrO2/c13-12-8-4-2-1-3-7(8)11(12)9(14)5-6-10(12)15/h1-6,11H/t11-,12-/m1/s1 |
| InChIKey | PBRUXBFVEGSBNK-VXGBXAGGSA-N |
| XLogP | 2.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|