C13H9ClO — CID 102339497
8-chlorotricyclo[6.3.2.02,7]trideca-2,4,6,10,12-pentaen-9-one (PubChem CID 102339497) has the molecular formula C13H9ClO and a molecular weight of 216.67 g/mol. Its IUPAC name is 8-chlorotricyclo[6.3.2.02,7]trideca-2,4,6,10,12-pentaen-9-one.
| Compound Name | 8-chlorotricyclo[6.3.2.02,7]trideca-2,4,6,10,12-pentaen-9-one |
|---|---|
| PubChem CID | 102339497 |
| Molecular Formula | C13H9ClO |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 8-chlorotricyclo[6.3.2.02,7]trideca-2,4,6,10,12-pentaen-9-one |
| SMILES | O=C1C=CC2C=CC1(Cl)c1ccccc12 |
| InChI | InChI=1S/C13H9ClO/c14-13-8-7-9(5-6-12(13)15)10-3-1-2-4-11(10)13/h1-9H |
| InChIKey | JASNWJPOAZVZHD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|