C38H58O7Si — CID 10604334
[(1R,2R,3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(1-ethoxyethoxy)-3-methoxy-4-methyl-1-[(3R)-1-oxaspiro[4.5]decan-3-yl]pentan-2-yl] acetate (PubChem CID 10604334) has the molecular formula C38H58O7Si and a molecular weight of 654.96 g/mol. Its IUPAC name is [(1R,2R,3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(1-ethoxyethoxy)-3-methoxy-4-methyl-1-[(3R)-1-oxaspiro[4.5]decan-3-yl]pentan-2-yl] acetate.
| Compound Name | [(1R,2R,3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(1-ethoxyethoxy)-3-methoxy-4-methyl-1-[(3R)-1-oxaspiro[4.5]decan-3-yl]pentan-2-yl] acetate |
|---|---|
| PubChem CID | 10604334 |
| Molecular Formula | C38H58O7Si |
| Molecular Weight | 654.96 g/mol |
| Exact Mass | 654.40 |
| IUPAC Name | [(1R,2R,3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(1-ethoxyethoxy)-3-methoxy-4-methyl-1-[(3R)-1-oxaspiro[4.5]decan-3-yl]pentan-2-yl] acetate |
| SMILES | CCOC(C)O[C@H]([C@H]1COC2(CCCCC2)C1)[C@H](OC(C)=O)[C@@H](OC)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H58O7Si/c1-9-41-30(4)45-35(31-25-38(42-27-31)23-17-12-18-24-38)36(44-29(3)39)34(40-8)28(2)26-43-46(37(5,6)7,32-19-13-10-14-20-32)33-21-15-11-16-22-33/h10-11,13-16,19-22,28,30-31,34-36H,9,12,17-18,23-27H2,1-8H3/t28-,30?,31+,34-,35+,36+/m0/s1 |
| InChIKey | XKKBVRKZPQLPDN-ZLIYQCPFSA-N |
| XLogP | 6.65 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.96 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|