C18H27NO5 — CID 10616919
diethyl 2-acetamido-2-[[(1R,2R,4S)-2-bicyclo[2.2.2]oct-5-enyl]methyl]propanedioate (PubChem CID 10616919) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[[(1R,2R,4S)-2-bicyclo[2.2.2]oct-5-enyl]methyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[[(1R,2R,4S)-2-bicyclo[2.2.2]oct-5-enyl]methyl]propanedioate |
|---|---|
| PubChem CID | 10616919 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | diethyl 2-acetamido-2-[[(1R,2R,4S)-2-bicyclo[2.2.2]oct-5-enyl]methyl]propanedioate |
| SMILES | CCOC(=O)C(C[C@H]1C[C@H]2C=C[C@@H]1CC2)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C18H27NO5/c1-4-23-16(21)18(19-12(3)20,17(22)24-5-2)11-15-10-13-6-8-14(15)9-7-13/h6,8,13-15H,4-5,7,9-11H2,1-3H3,(H,19,20)/t13-,14+,15+/m0/s1 |
| InChIKey | MQSKYLZFXDHAHH-RRFJBIMHSA-N |
| XLogP | 1.98 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|