C22H35NO5 — CID 101408407
diethyl 2-acetamido-2-(cyclododeca-1,2-dien-1-ylmethyl)propanedioate (PubChem CID 101408407) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is diethyl 2-acetamido-2-(cyclododeca-1,2-dien-1-ylmethyl)propanedioate.
| Compound Name | diethyl 2-acetamido-2-(cyclododeca-1,2-dien-1-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 101408407 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | diethyl 2-acetamido-2-(cyclododeca-1,2-dien-1-ylmethyl)propanedioate |
| SMILES | CCOC(=O)C(CC1=C=CCCCCCCCCC1)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C22H35NO5/c1-4-27-20(25)22(23-18(3)24,21(26)28-5-2)17-19-15-13-11-9-7-6-8-10-12-14-16-19/h13H,4-12,14,16-17H2,1-3H3,(H,23,24) |
| InChIKey | WCJCALOEHNMREK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|