C26H35NO2 — CID 10620606
2,2-dimethyl-6-phenyl-N-(2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl)hexanamide (PubChem CID 10620606) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is 2,2-dimethyl-6-phenyl-N-(2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl)hexanamide.
| Compound Name | 2,2-dimethyl-6-phenyl-N-(2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl)hexanamide |
|---|---|
| PubChem CID | 10620606 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 2,2-dimethyl-6-phenyl-N-(2,2,4,6-tetramethyl-3H-1-benzofuran-7-yl)hexanamide |
| SMILES | Cc1cc(C)c(NC(=O)C(C)(C)CCCCc2ccccc2)c2c1CC(C)(C)O2 |
| InChI | InChI=1S/C26H35NO2/c1-18-16-19(2)22(23-21(18)17-26(5,6)29-23)27-24(28)25(3,4)15-11-10-14-20-12-8-7-9-13-20/h7-9,12-13,16H,10-11,14-15,17H2,1-6H3,(H,27,28) |
| InChIKey | NWJCOQRMTAOTOX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|