C27H42F3NO6Si — CID 10626718
[(E,3S,4R)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(phenylmethoxymethoxy)pent-1-en-3-yl] 2,2,2-trifluoroethanimidate (PubChem CID 10626718) has the molecular formula C27H42F3NO6Si and a molecular weight of 561.71 g/mol. Its IUPAC name is [(E,3S,4R)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(phenylmethoxymethoxy)pent-1-en-3-yl] 2,2,2-trifluoroethanimidate.
| Compound Name | [(E,3S,4R)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(phenylmethoxymethoxy)pent-1-en-3-yl] 2,2,2-trifluoroethanimidate |
|---|---|
| PubChem CID | 10626718 |
| Molecular Formula | C27H42F3NO6Si |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | [(E,3S,4R)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(phenylmethoxymethoxy)pent-1-en-3-yl] 2,2,2-trifluoroethanimidate |
| SMILES | [H]/N=C(/O[C@@H](/C=C/[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C)[C@@H](C)OCOCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C27H42F3NO6Si/c1-19(33-18-32-16-20-12-10-9-11-13-20)21(35-24(31)27(28,29)30)14-15-22-23(37-26(5,6)36-22)17-34-38(7,8)25(2,3)4/h9-15,19,21-23,31H,16-18H2,1-8H3/b15-14+,31-24+/t19-,21+,22+,23+/m1/s1 |
| InChIKey | HSFFJWYXHUEHFR-QOINYVBVSA-N |
| XLogP | 6.59 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|