C10H14N2O4S4 — CID 106270467
5-[(1,1-dioxothiolan-3-yl)-methylsulfamoyl]thiophene-2-carbothioamide (PubChem CID 106270467) has the molecular formula C10H14N2O4S4 and a molecular weight of 354.50 g/mol. Its IUPAC name is 5-[(1,1-dioxothiolan-3-yl)-methylsulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[(1,1-dioxothiolan-3-yl)-methylsulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106270467 |
| Molecular Formula | C10H14N2O4S4 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 5-[(1,1-dioxothiolan-3-yl)-methylsulfamoyl]thiophene-2-carbothioamide |
| SMILES | CN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C10H14N2O4S4/c1-12(7-4-5-19(13,14)6-7)20(15,16)9-3-2-8(18-9)10(11)17/h2-3,7H,4-6H2,1H3,(H2,11,17) |
| InChIKey | IHPYSGAEGGYUPA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|