C45H45NO6 — CID 10628446
2-phenyl-4-[(E)-2-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 10628446) has the molecular formula C45H45NO6 and a molecular weight of 695.86 g/mol. Its IUPAC name is 2-phenyl-4-[(E)-2-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-phenyl-4-[(E)-2-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 10628446 |
| Molecular Formula | C45H45NO6 |
| Molecular Weight | 695.86 g/mol |
| Exact Mass | 695.32 |
| IUPAC Name | 2-phenyl-4-[(E)-2-[(2S,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | C(=C/[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)\C1COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C45H45NO6/c1-6-16-34(17-7-1)28-47-33-41-43(49-30-36-20-10-3-11-21-36)44(50-31-37-22-12-4-13-23-37)42(48-29-35-18-8-2-9-19-35)40(52-41)27-26-39-32-51-45(46-39)38-24-14-5-15-25-38/h1-27,39-44H,28-33H2/b27-26+/t39?,40-,41+,42-,43-,44+/m0/s1 |
| InChIKey | VLUZBZIBLUAKCT-KJBYQTLZSA-N |
| XLogP | 8.13 |
| TPSA | 67.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.86 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|