C22H29NO6S — CID 10646541
tert-butyl (1R,6R)-2-[2-(4-methylphenyl)sulfonyloxyacetyl]-9-azabicyclo[4.2.1]non-2-ene-9-carboxylate (PubChem CID 10646541) has the molecular formula C22H29NO6S and a molecular weight of 435.54 g/mol. Its IUPAC name is tert-butyl (1R,6R)-2-[2-(4-methylphenyl)sulfonyloxyacetyl]-9-azabicyclo[4.2.1]non-2-ene-9-carboxylate.
| Compound Name | tert-butyl (1R,6R)-2-[2-(4-methylphenyl)sulfonyloxyacetyl]-9-azabicyclo[4.2.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 10646541 |
| Molecular Formula | C22H29NO6S |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | tert-butyl (1R,6R)-2-[2-(4-methylphenyl)sulfonyloxyacetyl]-9-azabicyclo[4.2.1]non-2-ene-9-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=O)C2=CCC[C@@H]3CC[C@H]2N3C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H29NO6S/c1-15-8-11-17(12-9-15)30(26,27)28-14-20(24)18-7-5-6-16-10-13-19(18)23(16)21(25)29-22(2,3)4/h7-9,11-12,16,19H,5-6,10,13-14H2,1-4H3/t16-,19-/m1/s1 |
| InChIKey | VJDJNQPERTWOKF-VQIMIIECSA-N |
| XLogP | 3.76 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|