C30H33NO6 — CID 10649147
3-[(2R,3R,4S,5S)-5-[(1R)-1-hydroxy-2-phenylmethoxyethyl]-3,4-bis(phenylmethoxy)oxolan-2-yl]oxypropanenitrile (PubChem CID 10649147) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is 3-[(2R,3R,4S,5S)-5-[(1R)-1-hydroxy-2-phenylmethoxyethyl]-3,4-bis(phenylmethoxy)oxolan-2-yl]oxypropanenitrile.
| Compound Name | 3-[(2R,3R,4S,5S)-5-[(1R)-1-hydroxy-2-phenylmethoxyethyl]-3,4-bis(phenylmethoxy)oxolan-2-yl]oxypropanenitrile |
|---|---|
| PubChem CID | 10649147 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 3-[(2R,3R,4S,5S)-5-[(1R)-1-hydroxy-2-phenylmethoxyethyl]-3,4-bis(phenylmethoxy)oxolan-2-yl]oxypropanenitrile |
| SMILES | N#CCCO[C@@H]1O[C@@H]([C@H](O)COCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H33NO6/c31-17-10-18-34-30-29(36-21-25-15-8-3-9-16-25)28(35-20-24-13-6-2-7-14-24)27(37-30)26(32)22-33-19-23-11-4-1-5-12-23/h1-9,11-16,26-30,32H,10,18-22H2/t26-,27+,28+,29-,30-/m1/s1 |
| InChIKey | XWMVALJTZSUHMD-HBMYTODVSA-N |
| XLogP | 4.39 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|