C10H21N3 — CID 106649236
2-(cyclohexen-1-yl)-2-hydrazinyl-N,N-dimethylethanamine (PubChem CID 106649236) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-2-hydrazinyl-N,N-dimethylethanamine.
| Compound Name | 2-(cyclohexen-1-yl)-2-hydrazinyl-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 106649236 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 2-(cyclohexen-1-yl)-2-hydrazinyl-N,N-dimethylethanamine |
| SMILES | CN(C)CC(NN)C1=CCCCC1 |
| InChI | InChI=1S/C10H21N3/c1-13(2)8-10(12-11)9-6-4-3-5-7-9/h6,10,12H,3-5,7-8,11H2,1-2H3 |
| InChIKey | KRPKIKQLETVXHB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|