C20H33BrO4 — CID 10669635
methyl 4-[(E)-7-bromo-8-hydroxy-4,8-dimethylnon-3-enyl]-2-methoxycyclohex-3-ene-1-carboxylate (PubChem CID 10669635) has the molecular formula C20H33BrO4 and a molecular weight of 417.38 g/mol. Its IUPAC name is methyl 4-[(E)-7-bromo-8-hydroxy-4,8-dimethylnon-3-enyl]-2-methoxycyclohex-3-ene-1-carboxylate.
| Compound Name | methyl 4-[(E)-7-bromo-8-hydroxy-4,8-dimethylnon-3-enyl]-2-methoxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10669635 |
| Molecular Formula | C20H33BrO4 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | methyl 4-[(E)-7-bromo-8-hydroxy-4,8-dimethylnon-3-enyl]-2-methoxycyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1CCC(CC/C=C(\C)CCC(Br)C(C)(C)O)=CC1OC |
| InChI | InChI=1S/C20H33BrO4/c1-14(9-12-18(21)20(2,3)23)7-6-8-15-10-11-16(19(22)25-5)17(13-15)24-4/h7,13,16-18,23H,6,8-12H2,1-5H3/b14-7+ |
| InChIKey | LPEQTTWQZWEEMQ-VGOFMYFVSA-N |
| XLogP | 4.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|