C13H12O4 — CID 10681062
5-[oxiran-2-yl(prop-2-ynoxy)methyl]-1,3-benzodioxole (PubChem CID 10681062) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is 5-[oxiran-2-yl(prop-2-ynoxy)methyl]-1,3-benzodioxole.
| Compound Name | 5-[oxiran-2-yl(prop-2-ynoxy)methyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 10681062 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 5-[oxiran-2-yl(prop-2-ynoxy)methyl]-1,3-benzodioxole |
| SMILES | C#CCOC(c1ccc2c(c1)OCO2)C1CO1 |
| InChI | InChI=1S/C13H12O4/c1-2-5-14-13(12-7-15-12)9-3-4-10-11(6-9)17-8-16-10/h1,3-4,6,12-13H,5,7-8H2 |
| InChIKey | WUJJPFVOXCEONI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|