C19H14O3S — CID 135087068
5-(3-phenylsulfanyl-1-prop-2-ynoxyprop-2-ynyl)-1,3-benzodioxole (PubChem CID 135087068) has the molecular formula C19H14O3S and a molecular weight of 322.38 g/mol. Its IUPAC name is 5-(3-phenylsulfanyl-1-prop-2-ynoxyprop-2-ynyl)-1,3-benzodioxole.
| Compound Name | 5-(3-phenylsulfanyl-1-prop-2-ynoxyprop-2-ynyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 135087068 |
| Molecular Formula | C19H14O3S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 5-(3-phenylsulfanyl-1-prop-2-ynoxyprop-2-ynyl)-1,3-benzodioxole |
| SMILES | C#CCOC(C#CSc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H14O3S/c1-2-11-20-17(10-12-23-16-6-4-3-5-7-16)15-8-9-18-19(13-15)22-14-21-18/h1,3-9,13,17H,11,14H2 |
| InChIKey | VJTLYERXKUOORN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|