C8H4BrClF4O — CID 106942092
1-(3-bromo-2,6-difluorophenyl)-2-chloro-2,2-difluoroethanol (PubChem CID 106942092) has the molecular formula C8H4BrClF4O and a molecular weight of 307.47 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-2-chloro-2,2-difluoroethanol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-2-chloro-2,2-difluoroethanol |
|---|---|
| PubChem CID | 106942092 |
| Molecular Formula | C8H4BrClF4O |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 305.91 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-2-chloro-2,2-difluoroethanol |
| SMILES | OC(c1c(F)ccc(Br)c1F)C(F)(F)Cl |
| InChI | InChI=1S/C8H4BrClF4O/c9-3-1-2-4(11)5(6(3)12)7(15)8(10,13)14/h1-2,7,15H |
| InChIKey | ICSZGLSYQOBDQT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|