C14H20BrF2N3 — CID 106942947
(3-bromo-2,6-difluorophenyl)-(1,4-dimethyl-1,4-diazepan-2-yl)methanamine (PubChem CID 106942947) has the molecular formula C14H20BrF2N3 and a molecular weight of 348.24 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(1,4-dimethyl-1,4-diazepan-2-yl)methanamine.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(1,4-dimethyl-1,4-diazepan-2-yl)methanamine |
|---|---|
| PubChem CID | 106942947 |
| Molecular Formula | C14H20BrF2N3 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(1,4-dimethyl-1,4-diazepan-2-yl)methanamine |
| SMILES | CN1CCCN(C)C(C(N)c2c(F)ccc(Br)c2F)C1 |
| InChI | InChI=1S/C14H20BrF2N3/c1-19-6-3-7-20(2)11(8-19)14(18)12-10(16)5-4-9(15)13(12)17/h4-5,11,14H,3,6-8,18H2,1-2H3 |
| InChIKey | TYVIFAHFYJLUGQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|