C23H23NO8S2 — CID 10696903
dimethyl 8-methylsulfonyloxy-4-phenylmethoxy-8,9-dihydro-7H-thieno[3,2-f]quinoline-2,6-dicarboxylate (PubChem CID 10696903) has the molecular formula C23H23NO8S2 and a molecular weight of 505.57 g/mol. Its IUPAC name is dimethyl 8-methylsulfonyloxy-4-phenylmethoxy-8,9-dihydro-7H-thieno[3,2-f]quinoline-2,6-dicarboxylate.
| Compound Name | dimethyl 8-methylsulfonyloxy-4-phenylmethoxy-8,9-dihydro-7H-thieno[3,2-f]quinoline-2,6-dicarboxylate |
|---|---|
| PubChem CID | 10696903 |
| Molecular Formula | C23H23NO8S2 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | dimethyl 8-methylsulfonyloxy-4-phenylmethoxy-8,9-dihydro-7H-thieno[3,2-f]quinoline-2,6-dicarboxylate |
| SMILES | COC(=O)c1cc2c3c(cc(OCc4ccccc4)c2s1)N(C(=O)OC)CC(OS(C)(=O)=O)C3 |
| InChI | InChI=1S/C23H23NO8S2/c1-29-22(25)20-10-17-16-9-15(32-34(3,27)28)12-24(23(26)30-2)18(16)11-19(21(17)33-20)31-13-14-7-5-4-6-8-14/h4-8,10-11,15H,9,12-13H2,1-3H3 |
| InChIKey | MOJFQUVALYOQNW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|