C31H35Cl2N3O3S — CID 10698819
3-[benzyl-[(1-nitrososulfanylcyclohexyl)methyl]amino]propyl 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 10698819) has the molecular formula C31H35Cl2N3O3S and a molecular weight of 600.61 g/mol. Its IUPAC name is 3-[benzyl-[(1-nitrososulfanylcyclohexyl)methyl]amino]propyl 2-[2-(2,6-dichloroanilino)phenyl]acetate.
| Compound Name | 3-[benzyl-[(1-nitrososulfanylcyclohexyl)methyl]amino]propyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| PubChem CID | 10698819 |
| Molecular Formula | C31H35Cl2N3O3S |
| Molecular Weight | 600.61 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | 3-[benzyl-[(1-nitrososulfanylcyclohexyl)methyl]amino]propyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | O=NSC1(CN(CCCOC(=O)Cc2ccccc2Nc2c(Cl)cccc2Cl)Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C31H35Cl2N3O3S/c32-26-14-9-15-27(33)30(26)34-28-16-6-5-13-25(28)21-29(37)39-20-10-19-36(22-24-11-3-1-4-12-24)23-31(40-35-38)17-7-2-8-18-31/h1,3-6,9,11-16,34H,2,7-8,10,17-23H2 |
| InChIKey | RJVPYONGDQUUDQ-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.61 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|