C13H17NOS2 — CID 107033688
2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(4-sulfanylthiophen-2-yl)methanone (PubChem CID 107033688) has the molecular formula C13H17NOS2 and a molecular weight of 267.42 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(4-sulfanylthiophen-2-yl)methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(4-sulfanylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 107033688 |
| Molecular Formula | C13H17NOS2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(4-sulfanylthiophen-2-yl)methanone |
| SMILES | O=C(c1cc(S)cs1)N1CCC2CCCCC21 |
| InChI | InChI=1S/C13H17NOS2/c15-13(12-7-10(16)8-17-12)14-6-5-9-3-1-2-4-11(9)14/h7-9,11,16H,1-6H2 |
| InChIKey | VTOORSNWCHHAFL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|