C11H12BrF2NS — CID 107131387
2-bromo-4,6-difluoro-N-(thiolan-3-ylmethyl)aniline (PubChem CID 107131387) has the molecular formula C11H12BrF2NS and a molecular weight of 308.19 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-(thiolan-3-ylmethyl)aniline.
| Compound Name | 2-bromo-4,6-difluoro-N-(thiolan-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 107131387 |
| Molecular Formula | C11H12BrF2NS |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-(thiolan-3-ylmethyl)aniline |
| SMILES | Fc1cc(F)c(NCC2CCSC2)c(Br)c1 |
| InChI | InChI=1S/C11H12BrF2NS/c12-9-3-8(13)4-10(14)11(9)15-5-7-1-2-16-6-7/h3-4,7,15H,1-2,5-6H2 |
| InChIKey | IHRDJBWQLBBDAM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |