C16H26BClO4 — CID 10735083
(1S,2S,6R,8S)-4-[(1S)-1-chloro-3-(1,3-dioxolan-2-yl)propyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 10735083) has the molecular formula C16H26BClO4 and a molecular weight of 328.65 g/mol. Its IUPAC name is (1S,2S,6R,8S)-4-[(1S)-1-chloro-3-(1,3-dioxolan-2-yl)propyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (1S,2S,6R,8S)-4-[(1S)-1-chloro-3-(1,3-dioxolan-2-yl)propyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 10735083 |
| Molecular Formula | C16H26BClO4 |
| Molecular Weight | 328.65 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (1S,2S,6R,8S)-4-[(1S)-1-chloro-3-(1,3-dioxolan-2-yl)propyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@H](Cl)CCC4OCCO4)O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C16H26BClO4/c1-15(2)10-8-11(15)16(3)12(9-10)21-17(22-16)13(18)4-5-14-19-6-7-20-14/h10-14H,4-9H2,1-3H3/t10-,11-,12+,13+,16-/m0/s1 |
| InChIKey | ZPWQJVHOBWPUPW-WKIHFJMMSA-N |
| XLogP | 3.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.65 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|