C18H18Cl3N2P — CID 10739727
2,2-diphenyl-8-(trichloromethyl)-1,7-diaza-2λ5-phosphacycloocta-1,7-diene (PubChem CID 10739727) has the molecular formula C18H18Cl3N2P and a molecular weight of 399.69 g/mol. Its IUPAC name is 2,2-diphenyl-8-(trichloromethyl)-1,7-diaza-2λ5-phosphacycloocta-1,7-diene.
| Compound Name | 2,2-diphenyl-8-(trichloromethyl)-1,7-diaza-2λ5-phosphacycloocta-1,7-diene |
|---|---|
| PubChem CID | 10739727 |
| Molecular Formula | C18H18Cl3N2P |
| Molecular Weight | 399.69 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2,2-diphenyl-8-(trichloromethyl)-1,7-diaza-2λ5-phosphacycloocta-1,7-diene |
| SMILES | ClC(Cl)(Cl)/C1=N/CCCCP(c2ccccc2)(c2ccccc2)=N1 |
| InChI | InChI=1S/C18H18Cl3N2P/c19-18(20,21)17-22-13-7-8-14-24(23-17,15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2/b22-17- |
| InChIKey | PVWOAEJTNRYTDZ-XLNRJJMWSA-N |
| XLogP | 5.40 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|