C24H40O14Si — CID 10745806
[(2R,3R,4S,5R,6S)-5-acetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-(2-trimethylsilylethoxy)oxan-3-yl]oxy-3,4-dihydroxyoxan-2-yl]methyl acetate (PubChem CID 10745806) has the molecular formula C24H40O14Si and a molecular weight of 580.66 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-5-acetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-(2-trimethylsilylethoxy)oxan-3-yl]oxy-3,4-dihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-5-acetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-(2-trimethylsilylethoxy)oxan-3-yl]oxy-3,4-dihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10745806 |
| Molecular Formula | C24H40O14Si |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-5-acetyloxy-6-[(3R,4S,5R,6S)-4,5-diacetyloxy-6-(2-trimethylsilylethoxy)oxan-3-yl]oxy-3,4-dihydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@@H]2CO[C@@H](OCC[Si](C)(C)C)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H40O14Si/c1-12(25)32-10-16-18(29)19(30)21(35-14(3)27)24(37-16)38-17-11-33-23(31-8-9-39(5,6)7)22(36-15(4)28)20(17)34-13(2)26/h16-24,29-30H,8-11H2,1-7H3/t16-,17-,18+,19+,20+,21-,22-,23-,24+/m1/s1 |
| InChIKey | RRIYKTFEHDWCEQ-VENQHLRYSA-N |
| XLogP | -0.11 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|