C12H9N3 — CID 10750358
1a,9b-dihydro-1H-azirino[2,3-f][1,7]phenanthroline (PubChem CID 10750358) has the molecular formula C12H9N3 and a molecular weight of 195.23 g/mol. Its IUPAC name is 1a,9b-dihydro-1H-azirino[2,3-f][1,7]phenanthroline.
| Compound Name | 1a,9b-dihydro-1H-azirino[2,3-f][1,7]phenanthroline |
|---|---|
| PubChem CID | 10750358 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 1a,9b-dihydro-1H-azirino[2,3-f][1,7]phenanthroline |
| SMILES | c1cnc2c(c1)-c1ncccc1C1NC21 |
| InChI | InChI=1S/C12H9N3/c1-3-7-9-8(4-2-5-13-9)11-12(15-11)10(7)14-6-1/h1-6,11-12,15H |
| InChIKey | RFCKSSSQPMLUOO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|