C14H19N3O4S2 — CID 10760796
3-[(1R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-ethyl-1,3,5-thiadiazinane-2-thione (PubChem CID 10760796) has the molecular formula C14H19N3O4S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 3-[(1R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-ethyl-1,3,5-thiadiazinane-2-thione.
| Compound Name | 3-[(1R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-ethyl-1,3,5-thiadiazinane-2-thione |
|---|---|
| PubChem CID | 10760796 |
| Molecular Formula | C14H19N3O4S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 3-[(1R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-5-ethyl-1,3,5-thiadiazinane-2-thione |
| SMILES | CCN1CSC(=S)N(C(CO)[C@H](O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C14H19N3O4S2/c1-2-15-8-16(14(22)23-9-15)12(7-18)13(19)10-3-5-11(6-4-10)17(20)21/h3-6,12-13,18-19H,2,7-9H2,1H3/t12?,13-/m1/s1 |
| InChIKey | DQVNKDJTWZWOPR-ZGTCLIOFSA-N |
| XLogP | 1.56 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|