C34H44ClNO4S — CID 10769844
2-[7-[3-(2-chloroethoxy)-4-methoxyphenyl]-7-(4-methylphenyl)sulfanylheptyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 10769844) has the molecular formula C34H44ClNO4S and a molecular weight of 598.25 g/mol. Its IUPAC name is 2-[7-[3-(2-chloroethoxy)-4-methoxyphenyl]-7-(4-methylphenyl)sulfanylheptyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[7-[3-(2-chloroethoxy)-4-methoxyphenyl]-7-(4-methylphenyl)sulfanylheptyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 10769844 |
| Molecular Formula | C34H44ClNO4S |
| Molecular Weight | 598.25 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | 2-[7-[3-(2-chloroethoxy)-4-methoxyphenyl]-7-(4-methylphenyl)sulfanylheptyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)CN(CCCCCCC(Sc1ccc(C)cc1)c1ccc(OC)c(OCCCl)c1)CC2 |
| InChI | InChI=1S/C34H44ClNO4S/c1-25-10-13-29(14-11-25)41-34(27-12-15-30(37-2)33(22-27)40-20-17-35)9-7-5-6-8-18-36-19-16-26-21-31(38-3)32(39-4)23-28(26)24-36/h10-15,21-23,34H,5-9,16-20,24H2,1-4H3 |
| InChIKey | UCPKKHBZTKCRSR-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.25 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|