C41H49N5O10Si — CID 10771642
[(4S)-2-acetamido-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]-6,8-dioxo-1H-purin-4-yl] acetate (PubChem CID 10771642) has the molecular formula C41H49N5O10Si and a molecular weight of 799.95 g/mol. Its IUPAC name is [(4S)-2-acetamido-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]-6,8-dioxo-1H-purin-4-yl] acetate.
| Compound Name | [(4S)-2-acetamido-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]-6,8-dioxo-1H-purin-4-yl] acetate |
|---|---|
| PubChem CID | 10771642 |
| Molecular Formula | C41H49N5O10Si |
| Molecular Weight | 799.95 g/mol |
| Exact Mass | 799.32 |
| IUPAC Name | [(4S)-2-acetamido-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]-6,8-dioxo-1H-purin-4-yl] acetate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](N3C(=O)N=C4C(=O)NC(NC(C)=O)=N[C@@]43OC(C)=O)C[C@@H]2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C41H49N5O10Si/c1-25(47)42-37-44-36(49)35-41(45-37,55-26(2)48)46(38(50)43-35)34-23-32(56-57(8,9)39(3,4)5)33(54-34)24-53-40(27-13-11-10-12-14-27,28-15-19-30(51-6)20-16-28)29-17-21-31(52-7)22-18-29/h10-22,32-34H,23-24H2,1-9H3,(H2,42,44,45,47,49)/t32-,33+,34+,41-/m0/s1 |
| InChIKey | QUYOUQONPRCGBD-BFXKZGMSSA-N |
| XLogP | 5.23 |
| TPSA | 175.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.95 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|