C18H26O2 — CID 10778737
(2S,6S)-2-[(1E,3Z,5R)-3,5-dimethylocta-1,3-dien-7-ynyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran (PubChem CID 10778737) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (2S,6S)-2-[(1E,3Z,5R)-3,5-dimethylocta-1,3-dien-7-ynyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran.
| Compound Name | (2S,6S)-2-[(1E,3Z,5R)-3,5-dimethylocta-1,3-dien-7-ynyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 10778737 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (2S,6S)-2-[(1E,3Z,5R)-3,5-dimethylocta-1,3-dien-7-ynyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
| SMILES | C#CC[C@@H](C)/C=C(C)\C=C\[C@@H]1CC=C[C@@H](OC(C)C)O1 |
| InChI | InChI=1S/C18H26O2/c1-6-8-15(4)13-16(5)11-12-17-9-7-10-18(20-17)19-14(2)3/h1,7,10-15,17-18H,8-9H2,2-5H3/b12-11+,16-13-/t15-,17+,18+/m1/s1 |
| InChIKey | MRPSIKJEPGPLLT-ZSGSLFOFSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|