C22H34O2 — CID 134982294
(2S)-2-[(1E,3Z,5R,7E)-3-ethyl-5,9-dimethyldeca-1,3,7,9-tetraenyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran (PubChem CID 134982294) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (2S)-2-[(1E,3Z,5R,7E)-3-ethyl-5,9-dimethyldeca-1,3,7,9-tetraenyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran.
| Compound Name | (2S)-2-[(1E,3Z,5R,7E)-3-ethyl-5,9-dimethyldeca-1,3,7,9-tetraenyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 134982294 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (2S)-2-[(1E,3Z,5R,7E)-3-ethyl-5,9-dimethyldeca-1,3,7,9-tetraenyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
| SMILES | C=C(C)/C=C/C[C@@H](C)/C=C(\C=C\[C@@H]1CC=CC(OC(C)C)O1)CC |
| InChI | InChI=1S/C22H34O2/c1-7-20(16-19(6)11-8-10-17(2)3)14-15-21-12-9-13-22(24-21)23-18(4)5/h8-10,13-16,18-19,21-22H,2,7,11-12H2,1,3-6H3/b10-8+,15-14+,20-16-/t19-,21+,22?/m1/s1 |
| InChIKey | DYQRSYPWUYGIGG-VOYHPUAJSA-N |
| XLogP | 6.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|